About ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate
ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate (PubChem CID 150258197) has the molecular formula C28H40N2O2S
and a molecular weight of 468.71 g/mol. Its IUPAC name is ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate |
| PubChem CID | 150258197 |
| Molecular Formula | C28H40N2O2S |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(CCCCCCCCCC(C)(C)C)ccc2n1Cc1nccs1 |
| InChI | InChI=1S/C28H40N2O2S/c1-5-32-27(31)25-20-23-19-22(13-11-9-7-6-8-10-12-16-28(2,3)4)14-15-24(23)30(25)21-26-29-17-18-33-26/h14-15,17-20H,5-13,16,21H2,1-4H3 |
| InChIKey | GAZPYESAOYVFND-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate?
The IUPAC name of ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate (CID 150258197) is ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate.
What is the SMILES notation for ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate?
The canonical SMILES for ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate is CCOC(=O)c1cc2cc(CCCCCCCCCC(C)(C)C)ccc2n1Cc1nccs1.
What is the InChIKey of ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate?
The InChIKey is GAZPYESAOYVFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H40N2O2S/c1-5-32-27(31)25-20-23-19-22(13-11-9-7-6-8-10-12-16-28(2,3)4)14-15-24(23)30(25)21-26-29-17-18-33-26/h14-15,17-20H,5-13,16,21H2,1-4H3.
What are the key properties of ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate?
ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate has a molecular weight of 468.71 g/mol, XLogP of 8.03, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(10,10-dimethylundecyl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxylate is sourced from PubChem (CID 150258197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).