About 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone
1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone (PubChem CID 15026033) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone |
| PubChem CID | 15026033 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1c(C)nc2sc(C)cn12 |
| InChI | InChI=1S/C9H10N2OS/c1-5-4-11-8(7(3)12)6(2)10-9(11)13-5/h4H,1-3H3 |
| InChIKey | XKSSOIQVNPKPGR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone?
The IUPAC name of 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone (CID 15026033) is 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone.
What is the SMILES notation for 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone?
The canonical SMILES for 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone is CC(=O)c1c(C)nc2sc(C)cn12.
What is the InChIKey of 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone?
The InChIKey is XKSSOIQVNPKPGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c1-5-4-11-8(7(3)12)6(2)10-9(11)13-5/h4H,1-3H3.
What are the key properties of 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone?
1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone has a molecular weight of 194.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)ethanone is sourced from PubChem (CID 15026033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).