C11H16N2O — CID 150262171
1-cyclohexylpyrrole-2-carboxamide (PubChem CID 150262171) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-cyclohexylpyrrole-2-carboxamide.
| Compound Name | 1-cyclohexylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 150262171 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-cyclohexylpyrrole-2-carboxamide |
| SMILES | NC(=O)c1cccn1C1CCCCC1 |
| InChI | InChI=1S/C11H16N2O/c12-11(14)10-7-4-8-13(10)9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2,(H2,12,14) |
| InChIKey | GBTZMNPXCXCITL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |