About 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid
4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 150266954) has the molecular formula C18H28O4
and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 150266954 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CCCCCCCCCC(=O)C1(OC)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C18H28O4/c1-3-4-5-6-7-8-9-10-16(19)18(22-2)13-11-15(12-14-18)17(20)21/h11-13H,3-10,14H2,1-2H3,(H,20,21) |
| InChIKey | GCSZIUROBKPEQG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid (CID 150266954) is 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid is CCCCCCCCCC(=O)C1(OC)C=CC(C(=O)O)=CC1.
What is the InChIKey of 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is GCSZIUROBKPEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O4/c1-3-4-5-6-7-8-9-10-16(19)18(22-2)13-11-15(12-14-18)17(20)21/h11-13H,3-10,14H2,1-2H3,(H,20,21).
What are the key properties of 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid?
4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 308.42 g/mol, XLogP of 4.05, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decanoyl-4-methoxycyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 150266954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).