About 2-(4-azidophenoxy)-4,6-dimethylpyrimidine
2-(4-azidophenoxy)-4,6-dimethylpyrimidine (PubChem CID 150267035) has the molecular formula C12H11N5O
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-(4-azidophenoxy)-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-(4-azidophenoxy)-4,6-dimethylpyrimidine |
| PubChem CID | 150267035 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-(4-azidophenoxy)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(Oc2ccc(N=[N+]=[N-])cc2)n1 |
| InChI | InChI=1S/C12H11N5O/c1-8-7-9(2)15-12(14-8)18-11-5-3-10(4-6-11)16-17-13/h3-7H,1-2H3 |
| InChIKey | GCTJWKVDMUZPQG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-azidophenoxy)-4,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-azidophenoxy)-4,6-dimethylpyrimidine?
The IUPAC name of 2-(4-azidophenoxy)-4,6-dimethylpyrimidine (CID 150267035) is 2-(4-azidophenoxy)-4,6-dimethylpyrimidine.
What is the SMILES notation for 2-(4-azidophenoxy)-4,6-dimethylpyrimidine?
The canonical SMILES for 2-(4-azidophenoxy)-4,6-dimethylpyrimidine is Cc1cc(C)nc(Oc2ccc(N=[N+]=[N-])cc2)n1.
What is the InChIKey of 2-(4-azidophenoxy)-4,6-dimethylpyrimidine?
The InChIKey is GCTJWKVDMUZPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O/c1-8-7-9(2)15-12(14-8)18-11-5-3-10(4-6-11)16-17-13/h3-7H,1-2H3.
What are the key properties of 2-(4-azidophenoxy)-4,6-dimethylpyrimidine?
2-(4-azidophenoxy)-4,6-dimethylpyrimidine has a molecular weight of 241.25 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-azidophenoxy)-4,6-dimethylpyrimidine is sourced from PubChem (CID 150267035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).