About 3-butyl-1,2,4-triazole-1-carboxamide
3-butyl-1,2,4-triazole-1-carboxamide (PubChem CID 150268150) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-butyl-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | 3-butyl-1,2,4-triazole-1-carboxamide |
| PubChem CID | 150268150 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-butyl-1,2,4-triazole-1-carboxamide |
| SMILES | CCCCc1ncn(C(N)=O)n1 |
| InChI | InChI=1S/C7H12N4O/c1-2-3-4-6-9-5-11(10-6)7(8)12/h5H,2-4H2,1H3,(H2,8,12) |
| InChIKey | GCZFSGUHRORQTO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-butyl-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1,2,4-triazole-1-carboxamide?
The IUPAC name of 3-butyl-1,2,4-triazole-1-carboxamide (CID 150268150) is 3-butyl-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for 3-butyl-1,2,4-triazole-1-carboxamide?
The canonical SMILES for 3-butyl-1,2,4-triazole-1-carboxamide is CCCCc1ncn(C(N)=O)n1.
What is the InChIKey of 3-butyl-1,2,4-triazole-1-carboxamide?
The InChIKey is GCZFSGUHRORQTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O/c1-2-3-4-6-9-5-11(10-6)7(8)12/h5H,2-4H2,1H3,(H2,8,12).
What are the key properties of 3-butyl-1,2,4-triazole-1-carboxamide?
3-butyl-1,2,4-triazole-1-carboxamide has a molecular weight of 168.20 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 150268150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).