About 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile
2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 150268870) has the molecular formula C7H7F4NO
and a molecular weight of 197.13 g/mol. Its IUPAC name is 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile.
Analyze 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile?
The IUPAC name of 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile (CID 150268870) is 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile.
What is the SMILES notation for 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile?
The canonical SMILES for 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile is CC(C)(C(=O)C(F)C#N)C(F)(F)F.
What is the InChIKey of 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile?
The InChIKey is GDDHLJZARIGIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F4NO/c1-6(2,7(9,10)11)5(13)4(8)3-12/h4H,1-2H3.
What are the key properties of 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile?
2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile has a molecular weight of 197.13 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,5,5-tetrafluoro-4,4-dimethyl-3-oxopentanenitrile is sourced from PubChem (CID 150268870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).