About 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole
2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole (PubChem CID 150273975) has the molecular formula C19H22N2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole |
| PubChem CID | 150273975 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole |
| SMILES | CC(C)(C)c1ccc(N2NC=CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N2/c1-19(2,3)16-9-11-17(12-10-16)21-18(13-14-20-21)15-7-5-4-6-8-15/h4-14,18,20H,1-3H3 |
| InChIKey | GEDWFWKNPVTAJX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole?
The IUPAC name of 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole (CID 150273975) is 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole.
What is the SMILES notation for 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole?
The canonical SMILES for 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole is CC(C)(C)c1ccc(N2NC=CC2c2ccccc2)cc1.
What is the InChIKey of 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole?
The InChIKey is GEDWFWKNPVTAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2/c1-19(2,3)16-9-11-17(12-10-16)21-18(13-14-20-21)15-7-5-4-6-8-15/h4-14,18,20H,1-3H3.
What are the key properties of 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole?
2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole has a molecular weight of 278.40 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-3-phenyl-1,3-dihydropyrazole is sourced from PubChem (CID 150273975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).