C8H16O5S2 — CID 150278765
[(1R)-1-[(4S,5R)-2,2-dimethyl-5-sulfanyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate (PubChem CID 150278765) has the molecular formula C8H16O5S2 and a molecular weight of 256.34 g/mol. Its IUPAC name is [(1R)-1-[(4S,5R)-2,2-dimethyl-5-sulfanyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate.
| Compound Name | [(1R)-1-[(4S,5R)-2,2-dimethyl-5-sulfanyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 150278765 |
| Molecular Formula | C8H16O5S2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | [(1R)-1-[(4S,5R)-2,2-dimethyl-5-sulfanyl-1,3-dioxolan-4-yl]ethyl] methanesulfonate |
| SMILES | C[C@@H](OS(C)(=O)=O)[C@@H]1OC(C)(C)O[C@@H]1S |
| InChI | InChI=1S/C8H16O5S2/c1-5(13-15(4,9)10)6-7(14)12-8(2,3)11-6/h5-7,14H,1-4H3/t5-,6+,7-/m1/s1 |
| InChIKey | GFDBEEMEEYSLRM-DSYKOEDSSA-N |
| XLogP | 0.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|