C22H32N4O3S — CID 150279491
3,4,5-triethoxy-2-[6-(1H-1,2,4-triazol-5-ylsulfanyl)hexyl]-1H-indole (PubChem CID 150279491) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 3,4,5-triethoxy-2-[6-(1H-1,2,4-triazol-5-ylsulfanyl)hexyl]-1H-indole.
| Compound Name | 3,4,5-triethoxy-2-[6-(1H-1,2,4-triazol-5-ylsulfanyl)hexyl]-1H-indole |
|---|---|
| PubChem CID | 150279491 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3,4,5-triethoxy-2-[6-(1H-1,2,4-triazol-5-ylsulfanyl)hexyl]-1H-indole |
| SMILES | CCOc1ccc2[nH]c(CCCCCCSc3ncn[nH]3)c(OCC)c2c1OCC |
| InChI | InChI=1S/C22H32N4O3S/c1-4-27-18-13-12-16-19(21(18)29-6-3)20(28-5-2)17(25-16)11-9-7-8-10-14-30-22-23-15-24-26-22/h12-13,15,25H,4-11,14H2,1-3H3,(H,23,24,26) |
| InChIKey | GFGXJJXGPWCRHP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|