C12H15BrFN3O — CID 150280152
3-[[3-[(3E)-4-bromopenta-1,3-dien-2-yl]oxetan-3-yl]-fluoromethyl]-4-methyl-1,2,4-triazole (PubChem CID 150280152) has the molecular formula C12H15BrFN3O and a molecular weight of 316.17 g/mol. Its IUPAC name is 3-[[3-[(3E)-4-bromopenta-1,3-dien-2-yl]oxetan-3-yl]-fluoromethyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[[3-[(3E)-4-bromopenta-1,3-dien-2-yl]oxetan-3-yl]-fluoromethyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 150280152 |
| Molecular Formula | C12H15BrFN3O |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3-[[3-[(3E)-4-bromopenta-1,3-dien-2-yl]oxetan-3-yl]-fluoromethyl]-4-methyl-1,2,4-triazole |
| SMILES | C=C(/C=C(\C)Br)C1(C(F)c2nncn2C)COC1 |
| InChI | InChI=1S/C12H15BrFN3O/c1-8(4-9(2)13)12(5-18-6-12)10(14)11-16-15-7-17(11)3/h4,7,10H,1,5-6H2,2-3H3/b9-4+ |
| InChIKey | GFKFYGIXXQSPJN-RUDMXATFSA-N |
| XLogP | 2.70 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|