C21H18ClF2N5O — CID 150281372
4-chloro-1-(3,3-difluorooxan-4-yl)-2-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-c]quinoline (PubChem CID 150281372) has the molecular formula C21H18ClF2N5O and a molecular weight of 429.86 g/mol. Its IUPAC name is 4-chloro-1-(3,3-difluorooxan-4-yl)-2-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-c]quinoline.
| Compound Name | 4-chloro-1-(3,3-difluorooxan-4-yl)-2-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 150281372 |
| Molecular Formula | C21H18ClF2N5O |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 4-chloro-1-(3,3-difluorooxan-4-yl)-2-[(5-methylpyrazin-2-yl)methyl]imidazo[4,5-c]quinoline |
| SMILES | Cc1cnc(Cc2nc3c(Cl)nc4ccccc4c3n2C2CCOCC2(F)F)cn1 |
| InChI | InChI=1S/C21H18ClF2N5O/c1-12-9-26-13(10-25-12)8-17-28-18-19(14-4-2-3-5-15(14)27-20(18)22)29(17)16-6-7-30-11-21(16,23)24/h2-5,9-10,16H,6-8,11H2,1H3 |
| InChIKey | GFQSQZYETJCDOZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|