About N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide
N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide (PubChem CID 150285403) has the molecular formula C13H10ClF2N3O
and a molecular weight of 297.69 g/mol. Its IUPAC name is N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide |
| PubChem CID | 150285403 |
| Molecular Formula | C13H10ClF2N3O |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide |
| SMILES | O=C(/N=c1\ccccn1Cc1cccc(Cl)n1)C(F)F |
| InChI | InChI=1S/C13H10ClF2N3O/c14-10-5-3-4-9(17-10)8-19-7-2-1-6-11(19)18-13(20)12(15)16/h1-7,12H,8H2/b18-11+ |
| InChIKey | GGLXPVJUSCOZHW-WOJGMQOQSA-N |
| XLogP | 2.28 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide?
The IUPAC name of N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide (CID 150285403) is N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide.
What is the SMILES notation for N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide?
The canonical SMILES for N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide is O=C(/N=c1\ccccn1Cc1cccc(Cl)n1)C(F)F.
What is the InChIKey of N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide?
The InChIKey is GGLXPVJUSCOZHW-WOJGMQOQSA-N. The full InChI is InChI=1S/C13H10ClF2N3O/c14-10-5-3-4-9(17-10)8-19-7-2-1-6-11(19)18-13(20)12(15)16/h1-7,12H,8H2/b18-11+.
What are the key properties of N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide?
N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide has a molecular weight of 297.69 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(6-chloro-2-pyridinyl)methyl]-2-pyridinylidene]-2,2-difluoroacetamide is sourced from PubChem (CID 150285403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).