C7H8N2O5 — CID 150287852
2-(1-methoxy-2,4-dioxopyrimidin-5-yl)acetic acid (PubChem CID 150287852) has the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. Its IUPAC name is 2-(1-methoxy-2,4-dioxopyrimidin-5-yl)acetic acid.
| Compound Name | 2-(1-methoxy-2,4-dioxopyrimidin-5-yl)acetic acid |
|---|---|
| PubChem CID | 150287852 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2-(1-methoxy-2,4-dioxopyrimidin-5-yl)acetic acid |
| SMILES | COn1cc(CC(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H8N2O5/c1-14-9-3-4(2-5(10)11)6(12)8-7(9)13/h3H,2H2,1H3,(H,10,11)(H,8,12,13) |
| InChIKey | GGYMDMAXRQASFI-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |