About 1-chloro-2,3-difluorocyclobutene
1-chloro-2,3-difluorocyclobutene (PubChem CID 150289348) has the molecular formula C4H3ClF2
and a molecular weight of 124.52 g/mol. Its IUPAC name is 1-chloro-2,3-difluorocyclobutene.
Molecular Properties
| Compound Name | 1-chloro-2,3-difluorocyclobutene |
| PubChem CID | 150289348 |
| Molecular Formula | C4H3ClF2 |
| Molecular Weight | 124.52 g/mol |
| Exact Mass | 123.99 |
| IUPAC Name | 1-chloro-2,3-difluorocyclobutene |
| SMILES | FC1=C(Cl)CC1F |
| InChI | InChI=1S/C4H3ClF2/c5-2-1-3(6)4(2)7/h3H,1H2 |
| InChIKey | GHGHMHSRCLGOOZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2,3-difluorocyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3-difluorocyclobutene?
The IUPAC name of 1-chloro-2,3-difluorocyclobutene (CID 150289348) is 1-chloro-2,3-difluorocyclobutene.
What is the SMILES notation for 1-chloro-2,3-difluorocyclobutene?
The canonical SMILES for 1-chloro-2,3-difluorocyclobutene is FC1=C(Cl)CC1F.
What is the InChIKey of 1-chloro-2,3-difluorocyclobutene?
The InChIKey is GHGHMHSRCLGOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClF2/c5-2-1-3(6)4(2)7/h3H,1H2.
What are the key properties of 1-chloro-2,3-difluorocyclobutene?
1-chloro-2,3-difluorocyclobutene has a molecular weight of 124.52 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3-difluorocyclobutene is sourced from PubChem (CID 150289348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).