C19H38O6 — CID 150291237
2-[3-(1,1,1-trimethoxydecan-2-yloxy)propoxymethyl]oxirane (PubChem CID 150291237) has the molecular formula C19H38O6 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-[3-(1,1,1-trimethoxydecan-2-yloxy)propoxymethyl]oxirane.
| Compound Name | 2-[3-(1,1,1-trimethoxydecan-2-yloxy)propoxymethyl]oxirane |
|---|---|
| PubChem CID | 150291237 |
| Molecular Formula | C19H38O6 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 2-[3-(1,1,1-trimethoxydecan-2-yloxy)propoxymethyl]oxirane |
| SMILES | CCCCCCCCC(OCCCOCC1CO1)C(OC)(OC)OC |
| InChI | InChI=1S/C19H38O6/c1-5-6-7-8-9-10-12-18(19(20-2,21-3)22-4)24-14-11-13-23-15-17-16-25-17/h17-18H,5-16H2,1-4H3 |
| InChIKey | GHQANDPLGYAJBR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|