C27H26N4O3S2 — CID 150291976
6-(4-morpholin-4-ylbutoxy)-N-([1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)naphthalene-2-carboxamide (PubChem CID 150291976) has the molecular formula C27H26N4O3S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 6-(4-morpholin-4-ylbutoxy)-N-([1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)naphthalene-2-carboxamide.
| Compound Name | 6-(4-morpholin-4-ylbutoxy)-N-([1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 150291976 |
| Molecular Formula | C27H26N4O3S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 6-(4-morpholin-4-ylbutoxy)-N-([1,3]thiazolo[5,4-e][1,3]benzothiazol-2-yl)naphthalene-2-carboxamide |
| SMILES | O=C(Nc1nc2ccc3scnc3c2s1)c1ccc2cc(OCCCCN3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C27H26N4O3S2/c32-26(30-27-29-22-7-8-23-24(25(22)36-27)28-17-35-23)20-4-3-19-16-21(6-5-18(19)15-20)34-12-2-1-9-31-10-13-33-14-11-31/h3-8,15-17H,1-2,9-14H2,(H,29,30,32) |
| InChIKey | GHTXNEWYMODTQA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|