C19H24N2O3 — CID 150294769
tert-butyl N-[7-(propan-2-ylcarbamoyl)naphthalen-1-yl]carbamate (PubChem CID 150294769) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl N-[7-(propan-2-ylcarbamoyl)naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[7-(propan-2-ylcarbamoyl)naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 150294769 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl N-[7-(propan-2-ylcarbamoyl)naphthalen-1-yl]carbamate |
| SMILES | CC(C)NC(=O)c1ccc2cccc(NC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H24N2O3/c1-12(2)20-17(22)14-10-9-13-7-6-8-16(15(13)11-14)21-18(23)24-19(3,4)5/h6-12H,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | GIIURWZNJIJVIP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |