C14H17NO2 — CID 15029614
N-[(E)-2-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)ethenyl]formamide (PubChem CID 15029614) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is N-[(E)-2-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)ethenyl]formamide.
| Compound Name | N-[(E)-2-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)ethenyl]formamide |
|---|---|
| PubChem CID | 15029614 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-[(E)-2-(2-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)ethenyl]formamide |
| SMILES | COc1ccc2c(c1/C=C/NC=O)CCCC2 |
| InChI | InChI=1S/C14H17NO2/c1-17-14-7-6-11-4-2-3-5-12(11)13(14)8-9-15-10-16/h6-10H,2-5H2,1H3,(H,15,16)/b9-8+ |
| InChIKey | SLJGYCHFMUXSFP-CMDGGOBGSA-N |
| XLogP | 2.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|