About 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile
1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile (PubChem CID 15029709) has the molecular formula C14H8F2N2O3
and a molecular weight of 290.23 g/mol. Its IUPAC name is 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile |
| PubChem CID | 15029709 |
| Molecular Formula | C14H8F2N2O3 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile |
| SMILES | CC(=O)n1cc(C#N)c(-c2cccc3c2OC(F)(F)O3)c1 |
| InChI | InChI=1S/C14H8F2N2O3/c1-8(19)18-6-9(5-17)11(7-18)10-3-2-4-12-13(10)21-14(15,16)20-12/h2-4,6-7H,1H3 |
| InChIKey | UXEGPUFCXLOGNE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile?
The IUPAC name of 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile (CID 15029709) is 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile.
What is the SMILES notation for 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile?
The canonical SMILES for 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile is CC(=O)n1cc(C#N)c(-c2cccc3c2OC(F)(F)O3)c1.
What is the InChIKey of 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile?
The InChIKey is UXEGPUFCXLOGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F2N2O3/c1-8(19)18-6-9(5-17)11(7-18)10-3-2-4-12-13(10)21-14(15,16)20-12/h2-4,6-7H,1H3.
What are the key properties of 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile?
1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile has a molecular weight of 290.23 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-4-(2,2-difluoro-1,3-benzodioxol-4-yl)pyrrole-3-carbonitrile is sourced from PubChem (CID 15029709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).