About bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+)
bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) (PubChem CID 150299115) has the molecular formula C40H22F4N4Ru+
and a molecular weight of 735.71 g/mol. Its IUPAC name is bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+).
Molecular Properties
| Compound Name | bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) |
| PubChem CID | 150299115 |
| Molecular Formula | C40H22F4N4Ru+ |
| Molecular Weight | 735.71 g/mol |
| Exact Mass | 736.08 |
| IUPAC Name | bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) |
| SMILES | Fc1ccc(-c2nc3[c-]cccc3nc2-c2ccc(F)cc2)cc1.Fc1ccc(-c2nc3[c-]cccc3nc2-c2ccc(F)cc2)cc1.[Ru+3] |
| InChI | InChI=1S/2C20H11F2N2.Ru/c2*21-15-9-5-13(6-10-15)19-20(14-7-11-16(22)12-8-14)24-18-4-2-1-3-17(18)23-19;/h2*1-3,5-12H;/q2*-1;+3 |
| InChIKey | GRTBMSQUCFPJLS-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 735.71 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+)?
The IUPAC name of bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) (CID 150299115) is bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+).
What is the SMILES notation for bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+)?
The canonical SMILES for bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) is Fc1ccc(-c2nc3[c-]cccc3nc2-c2ccc(F)cc2)cc1.Fc1ccc(-c2nc3[c-]cccc3nc2-c2ccc(F)cc2)cc1.[Ru+3].
What is the InChIKey of bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+)?
The InChIKey is GRTBMSQUCFPJLS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H11F2N2.Ru/c2*21-15-9-5-13(6-10-15)19-20(14-7-11-16(22)12-8-14)24-18-4-2-1-3-17(18)23-19;/h2*1-3,5-12H;/q2*-1;+3.
What are the key properties of bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+)?
bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) has a molecular weight of 735.71 g/mol, XLogP of 10.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3-bis(4-fluorophenyl)-5H-quinoxalin-5-ide);ruthenium(3+) is sourced from PubChem (CID 150299115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).