About N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline
N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline (PubChem CID 150300077) has the molecular formula C16H16ClN
and a molecular weight of 257.76 g/mol. Its IUPAC name is N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline.
Molecular Properties
| Compound Name | N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline |
| PubChem CID | 150300077 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline |
| SMILES | C=CC=C(Cl)C1(Nc2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C16H16ClN/c1-2-9-15(17)16(12-7-4-8-13-16)18-14-10-5-3-6-11-14/h2-12,18H,1,13H2 |
| InChIKey | GJKNOEIPRASSPX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline?
The IUPAC name of N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline (CID 150300077) is N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline.
What is the SMILES notation for N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline?
The canonical SMILES for N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline is C=CC=C(Cl)C1(Nc2ccccc2)C=CC=CC1.
What is the InChIKey of N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline?
The InChIKey is GJKNOEIPRASSPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN/c1-2-9-15(17)16(12-7-4-8-13-16)18-14-10-5-3-6-11-14/h2-12,18H,1,13H2.
What are the key properties of N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline?
N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline has a molecular weight of 257.76 g/mol, XLogP of 4.66, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1-chlorobuta-1,3-dienyl)cyclohexa-2,4-dien-1-yl]aniline is sourced from PubChem (CID 150300077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).