About 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol
2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol (PubChem CID 150300967) has the molecular formula C14H11BrF2O
and a molecular weight of 313.14 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol |
| PubChem CID | 150300967 |
| Molecular Formula | C14H11BrF2O |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol |
| SMILES | OC(c1ccccc1)C(F)(F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H11BrF2O/c15-12-8-6-11(7-9-12)14(16,17)13(18)10-4-2-1-3-5-10/h1-9,13,18H |
| InChIKey | GJPGVSUMIHBORE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol?
The IUPAC name of 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol (CID 150300967) is 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol.
What is the SMILES notation for 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol?
The canonical SMILES for 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol is OC(c1ccccc1)C(F)(F)c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol?
The InChIKey is GJPGVSUMIHBORE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrF2O/c15-12-8-6-11(7-9-12)14(16,17)13(18)10-4-2-1-3-5-10/h1-9,13,18H.
What are the key properties of 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol?
2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol has a molecular weight of 313.14 g/mol, XLogP of 4.27, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-2,2-difluoro-1-phenylethanol is sourced from PubChem (CID 150300967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).