C27H45BrO5Si2 — CID 150301356
methyl (1S,2R,3aS,8bS)-7-bromo-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,8b-tetrahydrocyclopenta[b][1]benzofuran-5-carboxylate (PubChem CID 150301356) has the molecular formula C27H45BrO5Si2 and a molecular weight of 585.73 g/mol. Its IUPAC name is methyl (1S,2R,3aS,8bS)-7-bromo-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,8b-tetrahydrocyclopenta[b][1]benzofuran-5-carboxylate.
| Compound Name | methyl (1S,2R,3aS,8bS)-7-bromo-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,8b-tetrahydrocyclopenta[b][1]benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 150301356 |
| Molecular Formula | C27H45BrO5Si2 |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | methyl (1S,2R,3aS,8bS)-7-bromo-2-[tert-butyl(dimethyl)silyl]oxy-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methyl-2,3,3a,8b-tetrahydrocyclopenta[b][1]benzofuran-5-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2c1O[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C27H45BrO5Si2/c1-25(2,3)34(9,10)31-16-27(7)21(33-35(11,12)26(4,5)6)15-20-22(27)18-13-17(28)14-19(23(18)32-20)24(29)30-8/h13-14,20-22H,15-16H2,1-12H3/t20-,21+,22-,27-/m0/s1 |
| InChIKey | GJRFGMOGKIEJCZ-RJESQKRESA-N |
| XLogP | 7.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|