About phenyl 2-aminoethanesulfinate
phenyl 2-aminoethanesulfinate (PubChem CID 150303616) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is phenyl 2-aminoethanesulfinate.
Molecular Properties
| Compound Name | phenyl 2-aminoethanesulfinate |
| PubChem CID | 150303616 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | phenyl 2-aminoethanesulfinate |
| SMILES | NCCS(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H11NO2S/c9-6-7-12(10)11-8-4-2-1-3-5-8/h1-5H,6-7,9H2 |
| InChIKey | GKDBCOISYVNUAI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl 2-aminoethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-aminoethanesulfinate?
The IUPAC name of phenyl 2-aminoethanesulfinate (CID 150303616) is phenyl 2-aminoethanesulfinate.
What is the SMILES notation for phenyl 2-aminoethanesulfinate?
The canonical SMILES for phenyl 2-aminoethanesulfinate is NCCS(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-aminoethanesulfinate?
The InChIKey is GKDBCOISYVNUAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c9-6-7-12(10)11-8-4-2-1-3-5-8/h1-5H,6-7,9H2.
What are the key properties of phenyl 2-aminoethanesulfinate?
phenyl 2-aminoethanesulfinate has a molecular weight of 185.25 g/mol, XLogP of 0.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-aminoethanesulfinate is sourced from PubChem (CID 150303616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).