C26H32N6O12 — CID 150304630
[[4-(butanoyloxyamino)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino] butanoate (PubChem CID 150304630) has the molecular formula C26H32N6O12 and a molecular weight of 620.57 g/mol. Its IUPAC name is [[4-(butanoyloxyamino)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino] butanoate.
| Compound Name | [[4-(butanoyloxyamino)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino] butanoate |
|---|---|
| PubChem CID | 150304630 |
| Molecular Formula | C26H32N6O12 |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | [[4-(butanoyloxyamino)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxobutanoyl]amino] butanoate |
| SMILES | CCCC(=O)ONC(=O)C(NC(=O)CCN1C(=O)C=CC1=O)C(NC(=O)CCN1C(=O)C=CC1=O)C(=O)NOC(=O)CCC |
| InChI | InChI=1S/C26H32N6O12/c1-3-5-21(39)43-29-25(41)23(27-15(33)11-13-31-17(35)7-8-18(31)36)24(26(42)30-44-22(40)6-4-2)28-16(34)12-14-32-19(37)9-10-20(32)38/h7-10,23-24H,3-6,11-14H2,1-2H3,(H,27,33)(H,28,34)(H,29,41)(H,30,42) |
| InChIKey | GKIISIDWSGQJIS-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|