C9H13FN4O2 — CID 150307493
(1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol (PubChem CID 150307493) has the molecular formula C9H13FN4O2 and a molecular weight of 228.23 g/mol. Its IUPAC name is (1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol.
| Compound Name | (1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 150307493 |
| Molecular Formula | C9H13FN4O2 |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1R,2S,3R,5R)-2-fluoro-5-(hydroxymethyl)-3-(1,3,5-triazin-2-ylamino)cyclopentan-1-ol |
| SMILES | OC[C@H]1C[C@@H](Nc2ncncn2)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C9H13FN4O2/c10-7-6(1-5(2-15)8(7)16)14-9-12-3-11-4-13-9/h3-8,15-16H,1-2H2,(H,11,12,13,14)/t5-,6-,7+,8-/m1/s1 |
| InChIKey | GKXFCJUYPHOSCK-OOJXKGFFSA-N |
| XLogP | -0.64 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |