C18H34O — CID 15030839
(1R,3aR,4R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 15030839) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is (1R,3aR,4R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 15030839 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | (1R,3aR,4R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H](O)CCC[C@]12C |
| InChI | InChI=1S/C18H34O/c1-13(2)7-5-8-14(3)15-10-11-16-17(19)9-6-12-18(15,16)4/h13-17,19H,5-12H2,1-4H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | KJWMQESDDWGHHO-UYTYNIKBSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |