C23H36FN2O3+ — CID 150311174
tert-butyl-[[5-fluoro-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methoxy]-dimethylazanium (PubChem CID 150311174) has the molecular formula C23H36FN2O3+ and a molecular weight of 407.55 g/mol. Its IUPAC name is tert-butyl-[[5-fluoro-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methoxy]-dimethylazanium.
| Compound Name | tert-butyl-[[5-fluoro-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methoxy]-dimethylazanium |
|---|---|
| PubChem CID | 150311174 |
| Molecular Formula | C23H36FN2O3+ |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | tert-butyl-[[5-fluoro-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]phenyl]methoxy]-dimethylazanium |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2ccc(F)cc2CO[N+](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H36FN2O3/c1-22(2,3)26(7,8)28-16-18-15-19(24)9-10-20(18)17-11-13-25(14-12-17)21(27)29-23(4,5)6/h9-11,15H,12-14,16H2,1-8H3/q+1 |
| InChIKey | GLQSIQZLOXTIFU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|