About (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one
(4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one (PubChem CID 15031419) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one |
| PubChem CID | 15031419 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one |
| SMILES | COCO[C@H]1C=C(CO)C(=O)[C@@H]1OCOC |
| InChI | InChI=1S/C10H16O6/c1-13-5-15-8-3-7(4-11)9(12)10(8)16-6-14-2/h3,8,10-11H,4-6H2,1-2H3/t8-,10+/m0/s1 |
| InChIKey | YCCJYPBYARTNRY-WCBMZHEXSA-N |
| XLogP | -0.53 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one?
The IUPAC name of (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one (CID 15031419) is (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one.
What is the SMILES notation for (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one?
The canonical SMILES for (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one is COCO[C@H]1C=C(CO)C(=O)[C@@H]1OCOC.
What is the InChIKey of (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one?
The InChIKey is YCCJYPBYARTNRY-WCBMZHEXSA-N. The full InChI is InChI=1S/C10H16O6/c1-13-5-15-8-3-7(4-11)9(12)10(8)16-6-14-2/h3,8,10-11H,4-6H2,1-2H3/t8-,10+/m0/s1.
What are the key properties of (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one?
(4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one has a molecular weight of 232.23 g/mol, XLogP of -0.53, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-2-(hydroxymethyl)-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one is sourced from PubChem (CID 15031419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).