About ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate
ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate (PubChem CID 150316586) has the molecular formula C10H14N4O4S
and a molecular weight of 286.31 g/mol. Its IUPAC name is ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate |
| PubChem CID | 150316586 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)NNC1([N+](=O)[O-])C=CC=CC1 |
| InChI | InChI=1S/C10H14N4O4S/c1-2-18-9(15)11-8(19)12-13-10(14(16)17)6-4-3-5-7-10/h3-6,13H,2,7H2,1H3,(H2,11,12,15,19) |
| InChIKey | GMSSQLVPSMLWRT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate?
The IUPAC name of ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate (CID 150316586) is ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate.
What is the SMILES notation for ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate?
The canonical SMILES for ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate is CCOC(=O)NC(=S)NNC1([N+](=O)[O-])C=CC=CC1.
What is the InChIKey of ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate?
The InChIKey is GMSSQLVPSMLWRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O4S/c1-2-18-9(15)11-8(19)12-13-10(14(16)17)6-4-3-5-7-10/h3-6,13H,2,7H2,1H3,(H2,11,12,15,19).
What are the key properties of ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate?
ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate has a molecular weight of 286.31 g/mol, XLogP of 0.60, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[(1-nitrocyclohexa-2,4-dien-1-yl)amino]carbamothioyl]carbamate is sourced from PubChem (CID 150316586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).