C13H19N — CID 15032311
1-(2,6,7,7a-tetrahydro-1H-inden-5-yl)pyrrolidine (PubChem CID 15032311) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-(2,6,7,7a-tetrahydro-1H-inden-5-yl)pyrrolidine.
| Compound Name | 1-(2,6,7,7a-tetrahydro-1H-inden-5-yl)pyrrolidine |
|---|---|
| PubChem CID | 15032311 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-(2,6,7,7a-tetrahydro-1H-inden-5-yl)pyrrolidine |
| SMILES | C1=C2C=C(N3CCCC3)CCC2CC1 |
| InChI | InChI=1S/C13H19N/c1-2-9-14(8-1)13-7-6-11-4-3-5-12(11)10-13/h5,10-11H,1-4,6-9H2 |
| InChIKey | WDVLRIBGNRNAAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |