C31H32F3N3O2 — CID 150324933
5-cyclopropyl-4-[[7-(1,2,3,4-tetrahydroisoquinolin-6-yl)-7-azaspiro[3.5]nonan-2-ylidene]methyl]-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole (PubChem CID 150324933) has the molecular formula C31H32F3N3O2 and a molecular weight of 535.61 g/mol. Its IUPAC name is 5-cyclopropyl-4-[[7-(1,2,3,4-tetrahydroisoquinolin-6-yl)-7-azaspiro[3.5]nonan-2-ylidene]methyl]-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole.
| Compound Name | 5-cyclopropyl-4-[[7-(1,2,3,4-tetrahydroisoquinolin-6-yl)-7-azaspiro[3.5]nonan-2-ylidene]methyl]-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 150324933 |
| Molecular Formula | C31H32F3N3O2 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 5-cyclopropyl-4-[[7-(1,2,3,4-tetrahydroisoquinolin-6-yl)-7-azaspiro[3.5]nonan-2-ylidene]methyl]-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole |
| SMILES | FC(F)(F)Oc1ccccc1-c1noc(C2CC2)c1C=C1CC2(CCN(c3ccc4c(c3)CCNC4)CC2)C1 |
| InChI | InChI=1S/C31H32F3N3O2/c32-31(33,34)38-27-4-2-1-3-25(27)28-26(29(39-36-28)21-5-6-21)15-20-17-30(18-20)10-13-37(14-11-30)24-8-7-23-19-35-12-9-22(23)16-24/h1-4,7-8,15-16,21,35H,5-6,9-14,17-19H2 |
| InChIKey | GOKQUYLWCYSPCY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|