C22H28O6 — CID 150325639
2-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butanedioic acid (PubChem CID 150325639) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butanedioic acid.
| Compound Name | 2-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butanedioic acid |
|---|---|
| PubChem CID | 150325639 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[(8R,9S,13S,14S)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butanedioic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CCC2(O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H28O6/c1-21-8-6-15-14-5-3-13(23)10-12(14)2-4-16(15)17(21)7-9-22(21,28)18(20(26)27)11-19(24)25/h3,5,10,15-18,23,28H,2,4,6-9,11H2,1H3,(H,24,25)(H,26,27)/t15-,16-,17+,18?,21+,22?/m1/s1 |
| InChIKey | GOOUYIUYRCFKDA-CQGPOJJZSA-N |
| XLogP | 3.15 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |