About 2-benzyl-3,3-dimethyloxaziridine
2-benzyl-3,3-dimethyloxaziridine (PubChem CID 15032732) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-benzyl-3,3-dimethyloxaziridine.
Molecular Properties
| Compound Name | 2-benzyl-3,3-dimethyloxaziridine |
| PubChem CID | 15032732 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-benzyl-3,3-dimethyloxaziridine |
| SMILES | CC1(C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-10(2)11(12-10)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | FIMPWKWHCPNDNE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 15.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-3,3-dimethyloxaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3,3-dimethyloxaziridine?
The IUPAC name of 2-benzyl-3,3-dimethyloxaziridine (CID 15032732) is 2-benzyl-3,3-dimethyloxaziridine.
What is the SMILES notation for 2-benzyl-3,3-dimethyloxaziridine?
The canonical SMILES for 2-benzyl-3,3-dimethyloxaziridine is CC1(C)ON1Cc1ccccc1.
What is the InChIKey of 2-benzyl-3,3-dimethyloxaziridine?
The InChIKey is FIMPWKWHCPNDNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-10(2)11(12-10)8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3.
What are the key properties of 2-benzyl-3,3-dimethyloxaziridine?
2-benzyl-3,3-dimethyloxaziridine has a molecular weight of 163.22 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3,3-dimethyloxaziridine is sourced from PubChem (CID 15032732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).