C14H18OS — CID 15032882
(2S,3R)-2-pent-4-enyl-3-(phenylsulfanylmethyl)oxirane (PubChem CID 15032882) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is (2S,3R)-2-pent-4-enyl-3-(phenylsulfanylmethyl)oxirane.
| Compound Name | (2S,3R)-2-pent-4-enyl-3-(phenylsulfanylmethyl)oxirane |
|---|---|
| PubChem CID | 15032882 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (2S,3R)-2-pent-4-enyl-3-(phenylsulfanylmethyl)oxirane |
| SMILES | C=CCCC[C@@H]1O[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C14H18OS/c1-2-3-5-10-13-14(15-13)11-16-12-8-6-4-7-9-12/h2,4,6-9,13-14H,1,3,5,10-11H2/t13-,14-/m0/s1 |
| InChIKey | YNYIXRIHCYZZGT-KBPBESRZSA-N |
| XLogP | 3.90 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|