C18H20O2S — CID 15032891
(2R,4R,5R)-5-methyl-2-phenyl-4-(phenylsulfanylmethyl)-1,3-dioxane (PubChem CID 15032891) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is (2R,4R,5R)-5-methyl-2-phenyl-4-(phenylsulfanylmethyl)-1,3-dioxane.
| Compound Name | (2R,4R,5R)-5-methyl-2-phenyl-4-(phenylsulfanylmethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 15032891 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (2R,4R,5R)-5-methyl-2-phenyl-4-(phenylsulfanylmethyl)-1,3-dioxane |
| SMILES | C[C@@H]1CO[C@@H](c2ccccc2)O[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C18H20O2S/c1-14-12-19-18(15-8-4-2-5-9-15)20-17(14)13-21-16-10-6-3-7-11-16/h2-11,14,17-18H,12-13H2,1H3/t14-,17+,18-/m1/s1 |
| InChIKey | ARNTWYCJURDMAA-FHLIZLRMSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |