About 3-chloro-2H-pyridine-2,3-diamine
3-chloro-2H-pyridine-2,3-diamine (PubChem CID 150330273) has the molecular formula C5H8ClN3
and a molecular weight of 145.59 g/mol. Its IUPAC name is 3-chloro-2H-pyridine-2,3-diamine.
Molecular Properties
| Compound Name | 3-chloro-2H-pyridine-2,3-diamine |
| PubChem CID | 150330273 |
| Molecular Formula | C5H8ClN3 |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 3-chloro-2H-pyridine-2,3-diamine |
| SMILES | NC1N=CC=CC1(N)Cl |
| InChI | InChI=1S/C5H8ClN3/c6-5(8)2-1-3-9-4(5)7/h1-4H,7-8H2 |
| InChIKey | GPMZLGCMNYKCHE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2H-pyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2H-pyridine-2,3-diamine?
The IUPAC name of 3-chloro-2H-pyridine-2,3-diamine (CID 150330273) is 3-chloro-2H-pyridine-2,3-diamine.
What is the SMILES notation for 3-chloro-2H-pyridine-2,3-diamine?
The canonical SMILES for 3-chloro-2H-pyridine-2,3-diamine is NC1N=CC=CC1(N)Cl.
What is the InChIKey of 3-chloro-2H-pyridine-2,3-diamine?
The InChIKey is GPMZLGCMNYKCHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClN3/c6-5(8)2-1-3-9-4(5)7/h1-4H,7-8H2.
What are the key properties of 3-chloro-2H-pyridine-2,3-diamine?
3-chloro-2H-pyridine-2,3-diamine has a molecular weight of 145.59 g/mol, XLogP of -0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2H-pyridine-2,3-diamine is sourced from PubChem (CID 150330273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).