C17H16N2O3S — CID 15033192
ethyl 4-ethoxy-2-pyridin-4-ylthieno[2,3-b]pyridine-5-carboxylate (PubChem CID 15033192) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is ethyl 4-ethoxy-2-pyridin-4-ylthieno[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-ethoxy-2-pyridin-4-ylthieno[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 15033192 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | ethyl 4-ethoxy-2-pyridin-4-ylthieno[2,3-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2sc(-c3ccncc3)cc2c1OCC |
| InChI | InChI=1S/C17H16N2O3S/c1-3-21-15-12-9-14(11-5-7-18-8-6-11)23-16(12)19-10-13(15)17(20)22-4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | CFNLYABUQYYXNC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |