C24H29FN6S — CID 150332059
6-(7-fluoro-2-methylindazol-5-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine (PubChem CID 150332059) has the molecular formula C24H29FN6S and a molecular weight of 452.60 g/mol. Its IUPAC name is 6-(7-fluoro-2-methylindazol-5-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine.
| Compound Name | 6-(7-fluoro-2-methylindazol-5-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 150332059 |
| Molecular Formula | C24H29FN6S |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 6-(7-fluoro-2-methylindazol-5-yl)-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine |
| SMILES | CN1C(C)(C)CC(Nc2nc3cnc(-c4cc(F)c5nn(C)cc5c4)cc3s2)CC1(C)C |
| InChI | InChI=1S/C24H29FN6S/c1-23(2)10-16(11-24(3,4)31(23)6)27-22-28-19-12-26-18(9-20(19)32-22)14-7-15-13-30(5)29-21(15)17(25)8-14/h7-9,12-13,16H,10-11H2,1-6H3,(H,27,28) |
| InChIKey | GPWMDRPVPZQPEL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |