C10H10N4O4 — CID 15033699
8-azido-7-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocine (PubChem CID 15033699) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 8-azido-7-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocine.
| Compound Name | 8-azido-7-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocine |
|---|---|
| PubChem CID | 15033699 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 8-azido-7-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocine |
| SMILES | [N-]=[N+]=Nc1ccc2c(c1[N+](=O)[O-])OCCCCO2 |
| InChI | InChI=1S/C10H10N4O4/c11-13-12-7-3-4-8-10(9(7)14(15)16)18-6-2-1-5-17-8/h3-4H,1-2,5-6H2 |
| InChIKey | IMMOMRGCYZBGJR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 110.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|