About 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile
2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile (PubChem CID 150338018) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile |
| PubChem CID | 150338018 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile |
| SMILES | C[C@H](N)Cc1nc(C#N)cs1 |
| InChI | InChI=1S/C7H9N3S/c1-5(9)2-7-10-6(3-8)4-11-7/h4-5H,2,9H2,1H3/t5-/m0/s1 |
| InChIKey | GRCCOJZWGZVXFS-YFKPBYRVSA-N |
| XLogP | 0.90 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile?
The IUPAC name of 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile (CID 150338018) is 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile.
What is the SMILES notation for 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile?
The canonical SMILES for 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile is C[C@H](N)Cc1nc(C#N)cs1.
What is the InChIKey of 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile?
The InChIKey is GRCCOJZWGZVXFS-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H9N3S/c1-5(9)2-7-10-6(3-8)4-11-7/h4-5H,2,9H2,1H3/t5-/m0/s1.
What are the key properties of 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile?
2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile has a molecular weight of 167.24 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2-aminopropyl]-1,3-thiazole-4-carbonitrile is sourced from PubChem (CID 150338018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).