C9H10F5I — CID 15033845
1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclohexane (PubChem CID 15033845) has the molecular formula C9H10F5I and a molecular weight of 340.07 g/mol. Its IUPAC name is 1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclohexane.
| Compound Name | 1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclohexane |
|---|---|
| PubChem CID | 15033845 |
| Molecular Formula | C9H10F5I |
| Molecular Weight | 340.07 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 1-iodo-2-(1,1,2,3,3-pentafluoroprop-2-enyl)cyclohexane |
| SMILES | FC(F)=C(F)C(F)(F)C1CCCCC1I |
| InChI | InChI=1S/C9H10F5I/c10-7(8(11)12)9(13,14)5-3-1-2-4-6(5)15/h5-6H,1-4H2 |
| InChIKey | XVJSANYNVMPCQZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.07 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|