C10H8F12O2 — CID 15033876
1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propan-2-one (PubChem CID 15033876) has the molecular formula C10H8F12O2 and a molecular weight of 388.15 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propan-2-one.
| Compound Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propan-2-one |
|---|---|
| PubChem CID | 15033876 |
| Molecular Formula | C10H8F12O2 |
| Molecular Weight | 388.15 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propan-2-one |
| SMILES | CC(=O)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H8F12O2/c1-4(23)2-24-3-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h5H,2-3H2,1H3 |
| InChIKey | XYKNCEGWFFYRNO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|