About (2S)-2-azidobutanamide
(2S)-2-azidobutanamide (PubChem CID 150339312) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is (2S)-2-azidobutanamide.
Molecular Properties
| Compound Name | (2S)-2-azidobutanamide |
| PubChem CID | 150339312 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (2S)-2-azidobutanamide |
| SMILES | CC[C@H](N=[N+]=[N-])C(N)=O |
| InChI | InChI=1S/C4H8N4O/c1-2-3(4(5)9)7-8-6/h3H,2H2,1H3,(H2,5,9)/t3-/m0/s1 |
| InChIKey | GRJAEKOIAMRJSN-VKHMYHEASA-N |
| XLogP | 0.56 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-azidobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-azidobutanamide?
The IUPAC name of (2S)-2-azidobutanamide (CID 150339312) is (2S)-2-azidobutanamide.
What is the SMILES notation for (2S)-2-azidobutanamide?
The canonical SMILES for (2S)-2-azidobutanamide is CC[C@H](N=[N+]=[N-])C(N)=O.
What is the InChIKey of (2S)-2-azidobutanamide?
The InChIKey is GRJAEKOIAMRJSN-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8N4O/c1-2-3(4(5)9)7-8-6/h3H,2H2,1H3,(H2,5,9)/t3-/m0/s1.
What are the key properties of (2S)-2-azidobutanamide?
(2S)-2-azidobutanamide has a molecular weight of 128.13 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-azidobutanamide is sourced from PubChem (CID 150339312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).