C25H26Cl2N2O5 — CID 15033952
dimethyl 2,4-bis(3-chlorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate (PubChem CID 15033952) has the molecular formula C25H26Cl2N2O5 and a molecular weight of 505.40 g/mol. Its IUPAC name is dimethyl 2,4-bis(3-chlorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate.
| Compound Name | dimethyl 2,4-bis(3-chlorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 15033952 |
| Molecular Formula | C25H26Cl2N2O5 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | dimethyl 2,4-bis(3-chlorophenyl)-3,7-dimethyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
| SMILES | COC(=O)C12CN(C)CC(C(=O)OC)(C1=O)C(c1cccc(Cl)c1)N(C)C2c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H26Cl2N2O5/c1-28-13-24(22(31)33-3)19(15-7-5-9-17(26)11-15)29(2)20(16-8-6-10-18(27)12-16)25(14-28,21(24)30)23(32)34-4/h5-12,19-20H,13-14H2,1-4H3 |
| InChIKey | MIZNBULCYIWDBH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|