C27H32N2O5 — CID 15033955
dimethyl 3,7-dimethyl-2,4-bis(3-methylphenyl)-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate (PubChem CID 15033955) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is dimethyl 3,7-dimethyl-2,4-bis(3-methylphenyl)-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate.
| Compound Name | dimethyl 3,7-dimethyl-2,4-bis(3-methylphenyl)-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 15033955 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | dimethyl 3,7-dimethyl-2,4-bis(3-methylphenyl)-9-oxo-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
| SMILES | COC(=O)C12CN(C)CC(C(=O)OC)(C1=O)C(c1cccc(C)c1)N(C)C2c1cccc(C)c1 |
| InChI | InChI=1S/C27H32N2O5/c1-17-9-7-11-19(13-17)21-26(24(31)33-5)15-28(3)16-27(23(26)30,25(32)34-6)22(29(21)4)20-12-8-10-18(2)14-20/h7-14,21-22H,15-16H2,1-6H3 |
| InChIKey | AVWRCQVFTFTWCN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|