C15H17BClN3O2 — CID 150340844
2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetonitrile (PubChem CID 150340844) has the molecular formula C15H17BClN3O2 and a molecular weight of 317.59 g/mol. Its IUPAC name is 2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetonitrile.
| Compound Name | 2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 150340844 |
| Molecular Formula | C15H17BClN3O2 |
| Molecular Weight | 317.59 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-[4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-2-yl]acetonitrile |
| SMILES | CC1(C)OB(c2ccc3nn(CC#N)cc3c2Cl)OC1(C)C |
| InChI | InChI=1S/C15H17BClN3O2/c1-14(2)15(3,4)22-16(21-14)11-5-6-12-10(13(11)17)9-20(19-12)8-7-18/h5-6,9H,8H2,1-4H3 |
| InChIKey | GRRHIJQRVSKVER-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|