C21H23F3N6O4 — CID 150341729
6-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 150341729) has the molecular formula C21H23F3N6O4 and a molecular weight of 488.50 g/mol. Its IUPAC name is 6-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 150341729 |
| Molecular Formula | C21H23F3N6O4 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 6-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[(2S)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]oxy]propoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | [2H]C1([2H])N(C(=O)CCOC[C@H](C)Oc2cn[nH]c(=O)c2C(F)(F)F)C([2H])([2H])C([2H])([2H])N(c2ccc(C#N)cn2)C1([2H])[2H] |
| InChI | InChI=1S/C21H23F3N6O4/c1-14(34-16-12-27-28-20(32)19(16)21(22,23)24)13-33-9-4-18(31)30-7-5-29(6-8-30)17-3-2-15(10-25)11-26-17/h2-3,11-12,14H,4-9,13H2,1H3,(H,28,32)/t14-/m0/s1/i5D2,6D2,7D2,8D2 |
| InChIKey | GRVSBDZJTMKABW-ZKVKEOJESA-N |
| XLogP | 1.58 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|