About (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate
(Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate (PubChem CID 150342156) has the molecular formula C16H16F5O4-
and a molecular weight of 367.29 g/mol. Its IUPAC name is (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate.
Molecular Properties
| Compound Name | (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate |
| PubChem CID | 150342156 |
| Molecular Formula | C16H16F5O4- |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate |
| SMILES | C/C=C(/CC(O)(C(=O)[O-])C(F)(F)F)c1cc(CC)c(F)c(F)c1OC |
| InChI | InChI=1S/C16H17F5O4/c1-4-8-6-10(13(25-3)12(18)11(8)17)9(5-2)7-15(24,14(22)23)16(19,20)21/h5-6,24H,4,7H2,1-3H3,(H,22,23)/p-1/b9-5- |
| InChIKey | GRXYRYKFPBTNAK-UITAMQMPSA-M |
| XLogP | 2.37 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate?
The IUPAC name of (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate (CID 150342156) is (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate.
What is the SMILES notation for (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate?
The canonical SMILES for (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate is C/C=C(/CC(O)(C(=O)[O-])C(F)(F)F)c1cc(CC)c(F)c(F)c1OC.
What is the InChIKey of (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate?
The InChIKey is GRXYRYKFPBTNAK-UITAMQMPSA-M. The full InChI is InChI=1S/C16H17F5O4/c1-4-8-6-10(13(25-3)12(18)11(8)17)9(5-2)7-15(24,14(22)23)16(19,20)21/h5-6,24H,4,7H2,1-3H3,(H,22,23)/p-1/b9-5-.
What are the key properties of (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate?
(Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate has a molecular weight of 367.29 g/mol, XLogP of 2.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(5-ethyl-3,4-difluoro-2-methoxyphenyl)-2-hydroxy-2-(trifluoromethyl)hex-4-enoate is sourced from PubChem (CID 150342156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).